CAS 2896193-43-2 is the registry number for EBOV-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methyl-4,4-dioxo-10H-thieno[3,2-c][2,1]benzothiazepin-10-amine (CAS 2896193-43-2) is a chemical compound with the molecular formula C12H12N2O2S2 and a molecular weight of 280.4 g/mol. IUPAC name: 5-methyl-4,4-dioxo-10H-thieno[3,2-c][2,1]benzothiazepin-10-amine. InChIKey: JPLFHIQKWBDFPG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 5-methyl-4,4-dioxo-10H-thieno[3,2-c][2,1]benzothiazepin-10-amine |
| InChIKey | JPLFHIQKWBDFPG-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(C3=C(S1(=O)=O)C=CS3)N |
Computed by PubChem (NCBI)