CAS 36331-49-4 is the registry number for 4-Methyl-n'-(thiophen-2-ylmethylene)benzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide (CAS 36331-49-4) is a chemical compound with the molecular formula C12H12N2O2S2 and a molecular weight of 280.4 g/mol. IUPAC name: 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide. InChIKey: PMRVBPJVOSPFOE-UKTHLTGXSA-N.
| Molecular formula | C12H12N2O2S2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
| InChIKey | PMRVBPJVOSPFOE-UKTHLTGXSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=CS2 |
Computed by PubChem (NCBI)