CAS 7202-71-3 is the registry number for Ethyl 4-amino-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (CAS 7202-71-3) is a chemical compound with the molecular formula C12H12N2O2S2 and a molecular weight of 280.4 g/mol. IUPAC name: ethyl 4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate. InChIKey: BBGRRZHUVITJLE-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | ethyl 4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| InChIKey | BBGRRZHUVITJLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=S)S1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)