CAS 289687-09-8 is the registry number for 2-(Chloromethyl)-3,6,7,8-tetrahydro-4H-cyclopenta[g]quinazolin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one (CAS 289687-09-8) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 2-(chloromethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one. InChIKey: VIGAPQDVWPXQQQ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-(chloromethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-4-one |
| InChIKey | VIGAPQDVWPXQQQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C=C2C1)N=C(NC3=O)CCl |
Computed by PubChem (NCBI)