CAS 28973-48-0 appears in our catalog under these names: Dextromethorphan Impurity 9 ((+)-3-Methoxy-N-formylmorphinan), N-Formyl Dextromethorphan, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde (CAS 28973-48-0) is a chemical compound with the molecular formula C18H23NO2 and a molecular weight of 285.4 g/mol. IUPAC name: (1S,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde. InChIKey: FZNYYMPPLIJMRC-NJAFHUGGSA-N.
| Molecular formula | C18H23NO2 |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (1S,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
| InChIKey | FZNYYMPPLIJMRC-NJAFHUGGSA-N |
| SMILES | COC1=CC2=C(C[C@H]3[C@@H]4[C@]2(CCCC4)CCN3C=O)C=C1 |
Computed by PubChem (NCBI)