Products 51745-06-3
CAS 51745-06-3 is the registry number for (-)-N-Formyl-3-methoxymorphinan. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
(1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde (CAS 51745-06-3) is a chemical compound with the molecular formula C18H23NO2 and a molecular weight of 285.4 g/mol. IUPAC name: (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde. InChIKey: FZNYYMPPLIJMRC-CGTJXYLNSA-N.
| Molecular formula | C18H23NO2 |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
| InChIKey | FZNYYMPPLIJMRC-CGTJXYLNSA-N |
| SMILES | COC1=CC2=C(C[C@@H]3[C@H]4[C@@]2(CCCC4)CCN3C=O)C=C1 |
Computed by PubChem (NCBI)