Products 2901020-63-9
CAS 2901020-63-9 is the registry number for TLR7/8 antagonist 1. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg.
Methyl 4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-(2-methylpropyl)imidazo[4,5-c]quinoline-7-carboxylate (CAS 2901020-63-9) is a chemical compound with the molecular formula C24H27N5O2 and a molecular weight of 417.5 g/mol. IUPAC name: methyl 4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-(2-methylpropyl)imidazo[4,5-c]quinoline-7-carboxylate. InChIKey: ZLDNOUHDDANJBL-UHFFFAOYSA-N.
| Molecular formula | C24H27N5O2 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | methyl 4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-(2-methylpropyl)imidazo[4,5-c]quinoline-7-carboxylate |
| InChIKey | ZLDNOUHDDANJBL-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NC2=C(N1CC3=CC=C(C=C3)CN)C4=C(C=C(C=C4)C(=O)OC)N=C2N |
Computed by PubChem (NCBI)