CAS 1394854-51-3 appears in our catalog under these names: Ethyl 3-((2-(pyridin-3-yl)-6-(1,2,4,5-tetrahydro-3H-benzo[d]azepin-3-yl)pyrimidin-4-yl)amino)propanoate, 95%, 95%, GSK J5, GSK J5/ 100%, GSK J5, GSK-J5, 99.33%. Offered by: Chemat, Hubei YoungXin, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 200mg, 1mg, 5mg.
Ethyl 3-[[2-pyridin-3-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoate (CAS 1394854-51-3) is a chemical compound with the molecular formula C24H27N5O2 and a molecular weight of 417.5 g/mol. IUPAC name: ethyl 3-[[2-pyridin-3-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoate. InChIKey: LQPGVGSKBNXQDU-UHFFFAOYSA-N.
| Molecular formula | C24H27N5O2 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | ethyl 3-[[2-pyridin-3-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoate |
| InChIKey | LQPGVGSKBNXQDU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNC1=CC(=NC(=N1)C2=CN=CC=C2)N3CCC4=CC=CC=C4CC3 |
Computed by PubChem (NCBI)