CAS 851845-37-9 appears in our catalog under these names: AZD6703 free base, AZD 6703. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, Get quote.
N-cyclopropyl-4-methyl-3-[6-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3-yl]benzamide (CAS 851845-37-9) is a chemical compound with the molecular formula C24H27N5O2 and a molecular weight of 417.5 g/mol. IUPAC name: N-cyclopropyl-4-methyl-3-[6-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3-yl]benzamide. InChIKey: ZMAZXHICVRYLQN-UHFFFAOYSA-N.
| Molecular formula | C24H27N5O2 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | N-cyclopropyl-4-methyl-3-[6-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3-yl]benzamide |
| InChIKey | ZMAZXHICVRYLQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2CC2)N3C=NC4=C(C3=O)C=C(C=C4)N5CCN(CC5)C |
Computed by PubChem (NCBI)