CAS 2901082-76-4 is the registry number for 4-Methyl-3-(2-(methylamino)thiazol-5-yl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-3-[2-(methylamino)-1,3-thiazol-5-yl]phenol (CAS 2901082-76-4) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 4-methyl-3-[2-(methylamino)-1,3-thiazol-5-yl]phenol. InChIKey: HSBBEJVJYVYUQR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 4-methyl-3-[2-(methylamino)-1,3-thiazol-5-yl]phenol |
| InChIKey | HSBBEJVJYVYUQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)C2=CN=C(S2)NC |
Computed by PubChem (NCBI)