Products 2901084-77-1
CAS 2901084-77-1 is the registry number for 5-Bromo-1-(difluoromethyl)-3-fluoropyridin-2(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-(difluoromethyl)-3-fluoropyridin-2-one (CAS 2901084-77-1) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 5-bromo-1-(difluoromethyl)-3-fluoropyridin-2-one. InChIKey: OUIMHMGFQCZULW-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 5-bromo-1-(difluoromethyl)-3-fluoropyridin-2-one |
| InChIKey | OUIMHMGFQCZULW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N(C=C1Br)C(F)F)F |
Computed by PubChem (NCBI)