Products 2901106-63-4
CAS 2901106-63-4 is the registry number for 2-(1-Methyl-1H-indazol-3-yl)propan-2-amine hydrochloride, 96%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
2-(1-methylindazol-3-yl)propan-2-amine;hydrochloride (CAS 2901106-63-4) is a chemical compound with the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. IUPAC name: 2-(1-methylindazol-3-yl)propan-2-amine;hydrochloride. InChIKey: AGXXUNFHKOTZGR-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3 |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | 2-(1-methylindazol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | AGXXUNFHKOTZGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NN(C2=CC=CC=C21)C)N.Cl |
Computed by PubChem (NCBI)