Products 2901109-48-4
CAS 2901109-48-4 is the registry number for 1-bromo-3,5-dichloro-4-methoxy-2-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3,5-dichloro-4-methoxy-2-methylbenzene (CAS 2901109-48-4) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 1-bromo-3,5-dichloro-4-methoxy-2-methylbenzene. InChIKey: HCYQAJWYOYXJFH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O |
|---|---|
| Molecular weight | 269.95 g/mol |
| IUPAC name | 1-bromo-3,5-dichloro-4-methoxy-2-methylbenzene |
| InChIKey | HCYQAJWYOYXJFH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)OC)Cl)Br |
Computed by PubChem (NCBI)