Products 2901109-92-8

CAS 2901109-92-8 is the registry number for 2-(3-bromo-2-fluoro-6-methoxyphenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-(3-bromo-2-fluoro-6-methoxyphenyl)-1,3-dioxolane (CAS 2901109-92-8) is a chemical compound with the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. IUPAC name: 2-(3-bromo-2-fluoro-6-methoxyphenyl)-1,3-dioxolane. InChIKey: GRWVSDYKGXLANX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrFO3
Molecular weight277.09 g/mol
IUPAC name2-(3-bromo-2-fluoro-6-methoxyphenyl)-1,3-dioxolane
InChIKeyGRWVSDYKGXLANX-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)Br)F)C2OCCO2

Computed by PubChem (NCBI)