CAS 2901109-93-9 is the registry number for 5-isopropyl-2-methoxyisophthalaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methoxy-5-propan-2-ylbenzene-1,3-dicarbaldehyde (CAS 2901109-93-9) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-methoxy-5-propan-2-ylbenzene-1,3-dicarbaldehyde. InChIKey: VPOPFINKEXFSSO-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-methoxy-5-propan-2-ylbenzene-1,3-dicarbaldehyde |
| InChIKey | VPOPFINKEXFSSO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C=O)OC)C=O |
Computed by PubChem (NCBI)