Products 29021-91-8
CAS 29021-91-8 appears in our catalog under these names: 3-Dibenzofurancarboxylic acid, 98%, 3-Dibenzofurancarboxylic Acid, 98+%, 3–Dibenzofurancarboxylic Acid, 3-Dibenzofurancarboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
Dibenzofuran-3-carboxylic acid (CAS 29021-91-8) is a chemical compound with the molecular formula C13H8O3 and a molecular weight of 212.20 g/mol. IUPAC name: dibenzofuran-3-carboxylic acid. InChIKey: IPAZMLAVBPDMLK-UHFFFAOYSA-N.
| Molecular formula | C13H8O3 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | dibenzofuran-3-carboxylic acid |
| InChIKey | IPAZMLAVBPDMLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Dibenzofurancarboxylic acid, 8-oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylic acid, 8-oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylic acid, dibenzofuran-3-carboxylic acid, dibenzo[b,d]furan-3-carboxylic acid, 3-DibenzofurancarboxylicAcid