CAS 3722-51-8 appears in our catalog under these names: Sieber Linker, 3-Hydroxyxanthen-9-one, >98.0%(HPLC)(T), 3-Hydroxyxanthone, 99.68%, 3-Hydroxyxanthone, 98%, 3-Hydroxy-9H-xanthen-9-one, 98%. Offered by: Iris Biotech, TCI, MedChemExpress, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1kg, 1g, 5g, 5 g, 10mM/1mL, 25 g.
3-hydroxyxanthen-9-one (CAS 3722-51-8) is a chemical compound with the molecular formula C13H8O3 and a molecular weight of 212.20 g/mol. IUPAC name: 3-hydroxyxanthen-9-one. InChIKey: XCJHDJAODLKGLG-UHFFFAOYSA-N.
| Molecular formula | C13H8O3 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 3-hydroxyxanthen-9-one |
| InChIKey | XCJHDJAODLKGLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)