CAS 2786-05-2 appears in our catalog under these names: Dibenzo(b,d)furan–4–carboxylic acid, Dibenzofuran–4–carboxylic Acid, Dibenzofuran-4-carboxylic Acid 95%, dibenzo[b,d]furan-4-carboxylic acid, 98%, 98%, 4-Dibenzofurancarboxylic acid, 99.92%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 25g, 25 g, 1 g.
Dibenzofuran-4-carboxylic acid (CAS 2786-05-2) is a chemical compound with the molecular formula C13H8O3 and a molecular weight of 212.20 g/mol. IUPAC name: dibenzofuran-4-carboxylic acid. InChIKey: BSMAWCXKHJSJIB-UHFFFAOYSA-N.
| Molecular formula | C13H8O3 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | dibenzofuran-4-carboxylic acid |
| InChIKey | BSMAWCXKHJSJIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)