Products 29024-92-8
CAS 29024-92-8 is the registry number for 1-(N-Hydroxyimino)-1-phenylpropan-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(1Z)-1-hydroxyimino-1-phenylpropan-2-one (CAS 29024-92-8) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (1Z)-1-hydroxyimino-1-phenylpropan-2-one. InChIKey: YQHWURFNAULYNW-MDZDMXLPSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (1Z)-1-hydroxyimino-1-phenylpropan-2-one |
| InChIKey | YQHWURFNAULYNW-MDZDMXLPSA-N |
| SMILES | CC(=O)/C(=N\O)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)