Products 2905323-00-2
CAS 2905323-00-2 is the registry number for 1-(Prop-2-yn-1-yl)azetidine oxalate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Oxalic acid;1-prop-2-ynylazetidine (CAS 2905323-00-2) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: oxalic acid;1-prop-2-ynylazetidine. InChIKey: RDCDUCUXAQGOJQ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | oxalic acid;1-prop-2-ynylazetidine |
| InChIKey | RDCDUCUXAQGOJQ-UHFFFAOYSA-N |
| SMILES | C#CCN1CCC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)