CAS 2909-79-7 appears in our catalog under these names: 4-(tert-Butyl)-N,N-dimethylaniline 98%, 4-TERT-BUTYL-N,N-DIMETHYLANILINE, 98%, 4-tert-Butyl-N,N-dimethylaniline, 98%, 98%, 4-(tert-Butyl)-N,N-dimethylaniline, 98%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10G, 100mg, 250mg.
4-tert-butyl-N,N-dimethylaniline (CAS 2909-79-7) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 4-tert-butyl-N,N-dimethylaniline. InChIKey: SJDILFZCXQHCRB-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 4-tert-butyl-N,N-dimethylaniline |
| InChIKey | SJDILFZCXQHCRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)