CAS 2909-83-3 is the registry number for 2,6-Di-tert-butylaniline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-ditert-butylaniline (CAS 2909-83-3) is a chemical compound with the molecular formula C14H23N and a molecular weight of 205.34 g/mol. IUPAC name: 2,6-ditert-butylaniline. InChIKey: RZSUJIUTUGMZPG-UHFFFAOYSA-N.
| Molecular formula | C14H23N |
|---|---|
| Molecular weight | 205.34 g/mol |
| IUPAC name | 2,6-ditert-butylaniline |
| InChIKey | RZSUJIUTUGMZPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)C(C)(C)C)N |
Computed by PubChem (NCBI)