CAS 2909-84-4 appears in our catalog under these names: 2,4–Di–tert–butylaniline, 2,4-di-tert-Butylaniline hydrochloride, 2,4-Di-tert-butylaniline 98%, 2,4-Di-tert-butylaniline, 98%, 98%, 2,4-Di-tert-butylaniline, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg, 5g.
2,4-ditert-butylaniline (CAS 2909-84-4) is a chemical compound with the molecular formula C14H23N and a molecular weight of 205.34 g/mol. IUPAC name: 2,4-ditert-butylaniline. InChIKey: PWGOAQYJIYOGBG-UHFFFAOYSA-N.
| Molecular formula | C14H23N |
|---|---|
| Molecular weight | 205.34 g/mol |
| IUPAC name | 2,4-ditert-butylaniline |
| InChIKey | PWGOAQYJIYOGBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)C(C)(C)C |
Computed by PubChem (NCBI)