CAS 291275-46-2 is the registry number for (R)-1-(3-Chlorophenyl)-2-hydroxy-1-propanone. Offered by: TRC. Available pack sizes: 100mg, 1g.
(2R)-1-(3-chlorophenyl)-2-hydroxypropan-1-one (CAS 291275-46-2) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (2R)-1-(3-chlorophenyl)-2-hydroxypropan-1-one. InChIKey: PRVHLTNNKRCHGO-ZCFIWIBFSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (2R)-1-(3-chlorophenyl)-2-hydroxypropan-1-one |
| InChIKey | PRVHLTNNKRCHGO-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)C1=CC(=CC=C1)Cl)O |
Computed by PubChem (NCBI)