Products 2918836-20-9
CAS 2918836-20-9 is the registry number for 1-(2,3-dibromo-6-fluorophenyl)-2-fluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-dibromo-6-fluorophenyl)-2-fluoroethanone (CAS 2918836-20-9) is a chemical compound with the molecular formula C8H4Br2F2O and a molecular weight of 313.92 g/mol. IUPAC name: 1-(2,3-dibromo-6-fluorophenyl)-2-fluoroethanone. InChIKey: ULXJMFSLRGTARY-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2O |
|---|---|
| Molecular weight | 313.92 g/mol |
| IUPAC name | 1-(2,3-dibromo-6-fluorophenyl)-2-fluoroethanone |
| InChIKey | ULXJMFSLRGTARY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)CF)Br)Br |
Computed by PubChem (NCBI)