Products 2918848-74-3

CAS 2918848-74-3 is the registry number for 2-bromo-4-fluoro-5-methoxyphenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2-bromo-4-fluoro-5-methoxyphenyl) acetate (CAS 2918848-74-3) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: (2-bromo-4-fluoro-5-methoxyphenyl) acetate. InChIKey: DMGDVCKCCZUEII-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrFO3
Molecular weight263.06 g/mol
IUPAC name(2-bromo-4-fluoro-5-methoxyphenyl) acetate
InChIKeyDMGDVCKCCZUEII-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C=C(C(=C1)OC)F)Br

Computed by PubChem (NCBI)