Products 2918881-58-8

CAS 2918881-58-8 is the registry number for 2-fluoro-5-isopropoxy-3-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-propan-2-yloxy-3-(trifluoromethyl)benzoic acid (CAS 2918881-58-8) is a chemical compound with the molecular formula C11H10F4O3 and a molecular weight of 266.19 g/mol. IUPAC name: 2-fluoro-5-propan-2-yloxy-3-(trifluoromethyl)benzoic acid. InChIKey: NTMRYSQPQHQVRY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10F4O3
Molecular weight266.19 g/mol
IUPAC name2-fluoro-5-propan-2-yloxy-3-(trifluoromethyl)benzoic acid
InChIKeyNTMRYSQPQHQVRY-UHFFFAOYSA-N
SMILESCC(C)OC1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)O

Computed by PubChem (NCBI)