Products 444151-68-2

CAS 444151-68-2 is the registry number for 4-((2,2,3,3-Tetrafluoropropoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid (CAS 444151-68-2) is a chemical compound with the molecular formula C11H10F4O3 and a molecular weight of 266.19 g/mol. IUPAC name: 4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid. InChIKey: WBQDFRPLOUVDKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10F4O3
Molecular weight266.19 g/mol
IUPAC name4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid
InChIKeyWBQDFRPLOUVDKJ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1COCC(C(F)F)(F)F)C(=O)O

Computed by PubChem (NCBI)