Products 438466-00-3

CAS 438466-00-3 is the registry number for 3-((2,2,3,3-Tetrafluoropropoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid (CAS 438466-00-3) is a chemical compound with the molecular formula C11H10F4O3 and a molecular weight of 266.19 g/mol. IUPAC name: 3-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid. InChIKey: UJRKOQZRAZJBIT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10F4O3
Molecular weight266.19 g/mol
IUPAC name3-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid
InChIKeyUJRKOQZRAZJBIT-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)COCC(C(F)F)(F)F

Computed by PubChem (NCBI)