CAS 2918934-48-0 is the registry number for 2-(4-chloro-2-iodophenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-2-iodophenyl)-1,3-dioxolane (CAS 2918934-48-0) is a chemical compound with the molecular formula C9H8ClIO2 and a molecular weight of 310.51 g/mol. IUPAC name: 2-(4-chloro-2-iodophenyl)-1,3-dioxolane. InChIKey: OVFXBKHKFDTBJB-UHFFFAOYSA-N.
| Molecular formula | C9H8ClIO2 |
|---|---|
| Molecular weight | 310.51 g/mol |
| IUPAC name | 2-(4-chloro-2-iodophenyl)-1,3-dioxolane |
| InChIKey | OVFXBKHKFDTBJB-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2)Cl)I |
Computed by PubChem (NCBI)