CAS 936098-39-4 is the registry number for 4-Chloro-2-iodobenzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-(4-chloro-2-iodophenyl)acetate (CAS 936098-39-4) is a chemical compound with the molecular formula C9H8ClIO2 and a molecular weight of 310.51 g/mol. IUPAC name: methyl 2-(4-chloro-2-iodophenyl)acetate. InChIKey: YGSOBJJPAHOBDR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClIO2 |
|---|---|
| Molecular weight | 310.51 g/mol |
| IUPAC name | methyl 2-(4-chloro-2-iodophenyl)acetate |
| InChIKey | YGSOBJJPAHOBDR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)Cl)I |
Computed by PubChem (NCBI)