Products 936098-39-4

CAS 936098-39-4 is the registry number for 4-Chloro-2-iodobenzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-chloro-2-iodophenyl)acetate (CAS 936098-39-4) is a chemical compound with the molecular formula C9H8ClIO2 and a molecular weight of 310.51 g/mol. IUPAC name: methyl 2-(4-chloro-2-iodophenyl)acetate. InChIKey: YGSOBJJPAHOBDR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClIO2
Molecular weight310.51 g/mol
IUPAC namemethyl 2-(4-chloro-2-iodophenyl)acetate
InChIKeyYGSOBJJPAHOBDR-UHFFFAOYSA-N
SMILESCOC(=O)CC1=C(C=C(C=C1)Cl)I

Computed by PubChem (NCBI)