CAS 914643-09-7 appears in our catalog under these names: Methyl 2-chloro-3-iodo-4-methylbenzoate, 95%, Methyl 2–chloro–3–iodo–4–methylbenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-chloro-3-iodo-4-methylbenzoate (CAS 914643-09-7) is a chemical compound with the molecular formula C9H8ClIO2 and a molecular weight of 310.51 g/mol. IUPAC name: methyl 2-chloro-3-iodo-4-methylbenzoate. InChIKey: CJNFORDSNLJDJO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClIO2 |
|---|---|
| Molecular weight | 310.51 g/mol |
| IUPAC name | methyl 2-chloro-3-iodo-4-methylbenzoate |
| InChIKey | CJNFORDSNLJDJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)Cl)I |
Computed by PubChem (NCBI)