Products 2919561-27-4
CAS 2919561-27-4 is the registry number for 3,3-Dimethyl-2-oxoindoline-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-2-oxo-1H-indole-7-carboxylic acid (CAS 2919561-27-4) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 3,3-dimethyl-2-oxo-1H-indole-7-carboxylic acid. InChIKey: NXKNFRNELICGTJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3,3-dimethyl-2-oxo-1H-indole-7-carboxylic acid |
| InChIKey | NXKNFRNELICGTJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC(=C2NC1=O)C(=O)O)C |
Computed by PubChem (NCBI)