Products 2920048-75-3
CAS 2920048-75-3 is the registry number for tert-butyl 4-bromo-6-hydroxy-isoindoline-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Tert-butyl 4-bromo-6-hydroxy-1,3-dihydroisoindole-2-carboxylate (CAS 2920048-75-3) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl 4-bromo-6-hydroxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: ASRRPMZKNKYUAD-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-6-hydroxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | ASRRPMZKNKYUAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC(=C2)O)Br |
Computed by PubChem (NCBI)