Products 2920187-42-2
CAS 2920187-42-2 appears in our catalog under these names: tert-Butyl (S)-2-hydroxy-8-azaspiro[4.5]decane-8-carboxylate 98%, Caryophyllene oxide, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl (3S)-3-hydroxy-8-azaspiro[4.5]decane-8-carboxylate (CAS 2920187-42-2) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl (3S)-3-hydroxy-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: SSWIJCQQSRKHQR-NSHDSACASA-N.
| Molecular formula | C14H25NO3 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | tert-butyl (3S)-3-hydroxy-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | SSWIJCQQSRKHQR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC[C@@H](C2)O)CC1 |
Computed by PubChem (NCBI)