Products 2920218-25-1
CAS 2920218-25-1 is the registry number for (5R)-2-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
(5R)-2-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (CAS 2920218-25-1) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: (5R)-2-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine. InChIKey: AFDXZIWLADRNIM-LLVKDONJSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | (5R)-2-bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| InChIKey | AFDXZIWLADRNIM-LLVKDONJSA-N |
| SMILES | C1CCC2=C(C=CC(=C2)Br)[C@@H](C1)N |
Computed by PubChem (NCBI)