Products 2920233-06-1
CAS 2920233-06-1 is the registry number for tert-butyl N-[(3R)-6-bromo-2,3-dihydrobenzofuran-3-yl]carbamate, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[(3R)-6-bromo-2,3-dihydro-1-benzofuran-3-yl]carbamate (CAS 2920233-06-1) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl N-[(3R)-6-bromo-2,3-dihydro-1-benzofuran-3-yl]carbamate. InChIKey: DFJAUBAWNZPINB-JTQLQIEISA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl N-[(3R)-6-bromo-2,3-dihydro-1-benzofuran-3-yl]carbamate |
| InChIKey | DFJAUBAWNZPINB-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)