Products 2920233-60-7
CAS 2920233-60-7 is the registry number for (R)-6-(tert-Butoxycarbonyl)-6-azaspiro[3.4]octane-7-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid (CAS 2920233-60-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid. InChIKey: HZKVXWNBWVIDGE-SECBINFHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid |
| InChIKey | HZKVXWNBWVIDGE-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC2)C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)