Products 29206-05-1
CAS 29206-05-1 appears in our catalog under these names: 2–(5–methoxy–2–methylphenyl)–2–methylpropanoic acid, 2-(5-methoxy-2-methylphenyl)-2-methylpropanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 5g.
2-(5-methoxy-2-methylphenyl)-2-methylpropanoic acid (CAS 29206-05-1) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-(5-methoxy-2-methylphenyl)-2-methylpropanoic acid. InChIKey: VBCYUSGQWAYHKR-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-(5-methoxy-2-methylphenyl)-2-methylpropanoic acid |
| InChIKey | VBCYUSGQWAYHKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)