CAS 29206-06-2 appears in our catalog under these names: 2,2-Dimethyl-3-(4-methoxyphenyl)propanoic Acid, 3-(4-Methoxyphenyl)-2,2-dimethylpropanoic acid, 95%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g, 5g.
3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid (CAS 29206-06-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid. InChIKey: NYDAEBWSGUNHIF-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid |
| InChIKey | NYDAEBWSGUNHIF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)