Products 29206-06-2

CAS 29206-06-2 appears in our catalog under these names: 2,2-Dimethyl-3-(4-methoxyphenyl)propanoic Acid, 3-(4-Methoxyphenyl)-2,2-dimethylpropanoic acid, 95%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid (CAS 29206-06-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid. InChIKey: NYDAEBWSGUNHIF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name3-(4-methoxyphenyl)-2,2-dimethylpropanoic acid
InChIKeyNYDAEBWSGUNHIF-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC=C(C=C1)OC)C(=O)O

Computed by PubChem (NCBI)