CAS 2920749-16-0 is the registry number for Benzyl (R)-4-cyclopropyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 2920749-16-0) is a chemical compound with the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. IUPAC name: benzyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: XYQAHHYUGRDMPZ-LBPRGKRZSA-N.
| Molecular formula | C13H15NO5S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | benzyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | XYQAHHYUGRDMPZ-LBPRGKRZSA-N |
| SMILES | C1CC1[C@@H]2COS(=O)(=O)N2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)