CAS 396105-96-7 is the registry number for 4-[5-(Methylsulfonyl)-2,3-dihydro-1H-indol-1-yl]-4-oxobutanoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 5g.
4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid (CAS 396105-96-7) is a chemical compound with the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. IUPAC name: 4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid. InChIKey: XRHVWOVQSCNJFX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO5S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid |
| InChIKey | XRHVWOVQSCNJFX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N(CC2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)