Products 396105-96-7

CAS 396105-96-7 is the registry number for 4-[5-(Methylsulfonyl)-2,3-dihydro-1H-indol-1-yl]-4-oxobutanoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid (CAS 396105-96-7) is a chemical compound with the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. IUPAC name: 4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid. InChIKey: XRHVWOVQSCNJFX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO5S
Molecular weight297.33 g/mol
IUPAC name4-(5-methylsulfonyl-2,3-dihydroindol-1-yl)-4-oxobutanoic acid
InChIKeyXRHVWOVQSCNJFX-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC2=C(C=C1)N(CC2)C(=O)CCC(=O)O

Computed by PubChem (NCBI)