CAS 841275-85-2 appears in our catalog under these names: 3-[(1-Acetyl-2,3-dihydro-1h-indol-5-yl)sulfonyl]propanoic acid, 95%, 3-((1-Acetylindolin-5-yl)sulfonyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid (CAS 841275-85-2) is a chemical compound with the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. IUPAC name: 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid. InChIKey: PWTILJQVZSJQRY-UHFFFAOYSA-N.
| Molecular formula | C13H15NO5S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid |
| InChIKey | PWTILJQVZSJQRY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)