CAS 2921739-49-1 appears in our catalog under these names: 7-Bromo-6-methoxy-2-methyl-2H-indazole, 95%, 95%, 7-Bromo-6-methoxy-2-methyl-2H-indazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
7-bromo-6-methoxy-2-methylindazole (CAS 2921739-49-1) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-6-methoxy-2-methylindazole. InChIKey: FKMYRZQKAFGUBQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-6-methoxy-2-methylindazole |
| InChIKey | FKMYRZQKAFGUBQ-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=CC(=C(C2=N1)Br)OC |
Computed by PubChem (NCBI)