Products 2921857-47-6
CAS 2921857-47-6 is the registry number for 2-chloro-1,3-difluoro-5-(methoxymethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1,3-difluoro-5-(methoxymethoxy)benzene (CAS 2921857-47-6) is a chemical compound with the molecular formula C8H7ClF2O2 and a molecular weight of 208.59 g/mol. IUPAC name: 2-chloro-1,3-difluoro-5-(methoxymethoxy)benzene. InChIKey: QHQHOBMAYVOJCD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2 |
|---|---|
| Molecular weight | 208.59 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-5-(methoxymethoxy)benzene |
| InChIKey | QHQHOBMAYVOJCD-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C(=C1)F)Cl)F |
Computed by PubChem (NCBI)