Products 749230-34-0
CAS 749230-34-0 appears in our catalog under these names: 2-Chloro-1,3-difluoro-4-(methoxymethoxy)benzene, 95%, 2-Chloro-1,3-difluoro-4-(methoxymethoxy)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-chloro-1,3-difluoro-4-(methoxymethoxy)benzene (CAS 749230-34-0) is a chemical compound with the molecular formula C8H7ClF2O2 and a molecular weight of 208.59 g/mol. IUPAC name: 2-chloro-1,3-difluoro-4-(methoxymethoxy)benzene. InChIKey: JJDHPHAIQUGGPI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2 |
|---|---|
| Molecular weight | 208.59 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-4-(methoxymethoxy)benzene |
| InChIKey | JJDHPHAIQUGGPI-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)F)Cl)F |
Computed by PubChem (NCBI)