CAS 773868-63-6 is the registry number for (5-Chloro-2-(difluoromethoxy)phenyl)methanol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
[5-chloro-2-(difluoromethoxy)phenyl]methanol (CAS 773868-63-6) is a chemical compound with the molecular formula C8H7ClF2O2 and a molecular weight of 208.59 g/mol. IUPAC name: [5-chloro-2-(difluoromethoxy)phenyl]methanol. InChIKey: WRCKBMKBPHCJSS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2 |
|---|---|
| Molecular weight | 208.59 g/mol |
| IUPAC name | [5-chloro-2-(difluoromethoxy)phenyl]methanol |
| InChIKey | WRCKBMKBPHCJSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CO)OC(F)F |
Computed by PubChem (NCBI)