Products 2921868-92-8

CAS 2921868-92-8 is the registry number for 5-bromo-2-methoxy-4-methylphenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-bromo-2-methoxy-4-methylphenyl) acetate (CAS 2921868-92-8) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: (5-bromo-2-methoxy-4-methylphenyl) acetate. InChIKey: PJUVBJYWVRMEFM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC name(5-bromo-2-methoxy-4-methylphenyl) acetate
InChIKeyPJUVBJYWVRMEFM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Br)OC(=O)C)OC

Computed by PubChem (NCBI)