CAS 2921868-92-8 is the registry number for 5-bromo-2-methoxy-4-methylphenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-bromo-2-methoxy-4-methylphenyl) acetate (CAS 2921868-92-8) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: (5-bromo-2-methoxy-4-methylphenyl) acetate. InChIKey: PJUVBJYWVRMEFM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | (5-bromo-2-methoxy-4-methylphenyl) acetate |
| InChIKey | PJUVBJYWVRMEFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)OC(=O)C)OC |
Computed by PubChem (NCBI)