CAS 2922195-89-7 is the registry number for 8-Bromo-6-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (CAS 2922195-89-7) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 8-bromo-6-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine. InChIKey: ICPKBULQBXZSCN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 8-bromo-6-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
| InChIKey | ICPKBULQBXZSCN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C(=CC(=N2)Cl)Br |
Computed by PubChem (NCBI)