Products 2922283-52-9
CAS 2922283-52-9 is the registry number for 6-(Trifluoromethyl)quinoline-5-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-(trifluoromethyl)quinoline-5-carboxylic acid (CAS 2922283-52-9) is a chemical compound with the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. IUPAC name: 6-(trifluoromethyl)quinoline-5-carboxylic acid. InChIKey: IULJSBDWBKGFFA-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO2 |
|---|---|
| Molecular weight | 241.17 g/mol |
| IUPAC name | 6-(trifluoromethyl)quinoline-5-carboxylic acid |
| InChIKey | IULJSBDWBKGFFA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=O)O)C(F)(F)F)N=C1 |
Computed by PubChem (NCBI)